![Schisandrol B [58546-54-6] Schisandrol B [58546-54-6]](https://www.targetmol.com/group3/M00/37/CD/CgoaEGayUe2EHJ8GAAAAAKuTwwc457.png)
Schisandrol B [58546-54-6]
T6S1917
CAS Number58546-54-6
Product group Chemicals
Estimated Purity99.32%
Molecular Weight416.46
Overview
- SupplierTargetMol Chemicals
- Product NameSchisandrol B
- Delivery Days Customer4
- CAS Number58546-54-6
- Category SupplierChemical
- CertificationResearch Use Only
- Chemical NameSchisandrol B
- Estimated Purity99.32%
- Molecular FormulaC23H28O7
- Molecular Weight416.46
- Scientific Description1. Schisandrol B (Besigomsin) may exert neuroprotective effects by attenuating the microglia-mediated neuroinflammatory response via inhibiting the TLR4-mediated NF-kappaB and MAPKs signaling pathways. 2. Schisandrol B has anti-inflammatory property, potentially result from the inhibition of COX-2, iNOS, IL-6, TNF-alpha and NO through the down-regulation of RIP2 and NF-kappaB activation. 3. Schisandrol B induces marked protective effects against hepatic and renal injury induced by CCl(4) exposure through differential regulation of the MAPK signal transduction pathway. 4. Schisandrol B significantly inhibits cell proliferation in a dose-dependent manner, due to cell cycle arrest in the G1 phase with the downregulation of cyclin D1 expression and Retinoblastoma (RB) phosphorylation.
- Shelf life instruction3 years
- SMILESCOc1cc2CC(C)(O)C(C)Cc3cc4OCOc4c(OC)c3-c2c(OC)c1OC
- Storage Instruction-20°C
- UNSPSC12352200