Sodium ionophore X
HY-W020249
CAS Number97600-39-0
Product group Chemicals
Estimated Purity98.0
Molecular Weight993.27
Overview
- SupplierMedChem Express
- Product NameSodium ionophore X [97600-39-0]
- Delivery Days Customer9
- CAS Number97600-39-0
- CertificationResearch Use Only
- Estimated Purity98.0
- Molecular FormulaC60H80O12
- Molecular Weight993.27
- Scientific DescriptionSodium ionophore X, a substituted calixarene, exhibits remarkably high ionophoric properties for metal ions and serves as a synergistic agent in the solvent extraction of lanthanoids alongside a thenoyltrifluoroacetone compound. Additionally, it plays a crucial role in the preparation of potentiometric membranes.
- SMILESO=C(OCC)COC(C(CC1=CC(C(C)(C)C)=CC(CC2=CC(C(C)(C)C)=CC3=C2OCC(OCC)=O)=C1OCC(OCC)=O)=CC(C(C)(C)C)=C4)=C4CC5=CC(C(C)(C)C)=CC(C3)=C5OCC(OCC)=O
- Storage Instruction-20°C,2°C to 8°C
- UNSPSC12352200