Stellettin B
ORB2663449
Estimated Purity98.00%
Product group Chemicals
Molecular Weight462.62
Overview
- SupplierBiorbyt
- Product NameStellettin B
- Delivery Days Customer10
- CertificationResearch Use Only
- Estimated Purity98.00%
- Molecular FormulaC30H38O4
- Molecular Weight462.62
- Scientific DescriptionStellettin B, a triterpene compound isolated from the marine sponge Jaspis stellifera, has demonstrated notable anticancer properties. It induces G1 phase arrest, apoptosis, and autophagy in human non-small cell lung cancer A549 cells by inhibiting the PI3K/Akt/mTOR pathway. Additionally, Stellettin B reduces migration and invasion in hepatocellular carcinoma cells through the suppression of the MAPK and FAK/PI3K/AKT/mTOR signaling pathways. This compound is utilized in various cancer research studies.
- SMILESC[C@@]1\2[C@]([C@]3(C)[C@@](CC1)(C(C)(C)C(=O)CC3)[H])(CC(=O)/C2=C(\C=C\C=C(/C)\C=4OC(=O)C(C)=CC4)/C)[H]
- Storage Instruction-20°C
- UNSPSC12352200