Sulfo-Cy7.5 alkyne

MedChem Express

Sulfo-Cy7.5 alkyne

14

Research Use Only

C48H48K3N3O13S4

1120.46

Sulfo-Cy7.5 alkyne is a dye derivative of Cyanine 7.5 (Cy7.5) (HY-D0926) containing a sulfonate ion and an alkyne functional group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy7.5 is a near-infrared fluorescent dye commonly used for biolabeling and cell imaging. The alkyne functionality of Sulfo-Cy7.5 alkyne can react with molecules containing the azide functionality to form covalent bonds. Sulfo-Cy7.5 alkyne can bind to biomolecules such as proteins and antibodies to track their location and dynamic changes in biological samples.

CN(/C(C1(C)C)=C/C=C2CCCC(/C=C/C3=[N+](CCCCCC(NCC#C)=O)C(C=CC4=C5C=C(S(=O)(O[K])=O)C=C4S([O-])(=O)=O)=C5C3(C)C)=C\2)C6=C1C(C=C(S(=O)(O[K])=O)C=C7S(=O)(O[K])=O)=C7C=C6

41116134