Thielavin B [71950-67-9]
HY-N10226
Overview
- SupplierMedChem Express
- Product NameThielavin B [71950-67-9]
- Delivery Days Customer10
- CAS Number71950-67-9
- CertificationResearch Use Only
- Molecular FormulaC31H34O10
- Molecular Weight566.60
- Scientific DescriptionThielavin B is an inhibitor of prostaglandin biosynthesis produced by Thielavia terricola. Thielavin B effectively influences the prostaglandin E2 synthesis from the endoperoxide. Thielavin B is significantly effective on carrageenan-induced oedema of rats when administered intravenously[1].
- SMILESOC1=C(C(O)=C(C(C)=C1)C(OC2=C(C(C)=C(C(OC)=C2C)C(OC3=C(C(C)=C(C(OC)=C3C)C(O)=O)C)=O)C)=O)C
- UNSPSC12131703