
Chemical Structure
Tributylmethylammonium chloride [56375-79-2] [56375-79-2]
CDX-T0607
CAS Number56375-79-2
Product group Chemicals
Estimated Purity>98%
Molecular Weight235.84
Overview
- SupplierChemodex
- Product NameTributylmethylammonium chloride [56375-79-2] [56375-79-2]
- Delivery Days Customer10
- CAS Number56375-79-2
- CertificationResearch Use Only
- Estimated Purity>98%
- Hazard InformationWarning
- Molecular FormulaC13H30ClN
- Molecular Weight235.84
- Scientific DescriptionChemical. CAS: 56375-79-2. Formula: C13H30ClN. MW: 235.84. Tributylmethylammonium chloride (TBMAC) is a quaternary ammonium salt used in various chemical and biochemical applications. It consists of a tetrabutylammonium cation (Bu3N+) and a chloride anion (Cl-), with a methyl group (CH3) attached to the nitrogen atom of the ammonium cation. TBMAC is commonly used as a phase-transfer catalyst (PTC) in organic synthesis. Phase-transfer catalysis involves the transfer of reactants from one phase (usually an aqueous phase) to another phase (usually an organic phase) to facilitate a chemical reaction. TBMAC helps in the transfer of ions or molecules between these phases, allowing reactions that might not occur under standard conditions. Some common applications of TBMAC include, nucleophilic substitution reactions, halogenation reactions or alkylation and acylation reactions. - Tributylmethylammonium chloride (TBMAC) is a quaternary ammonium salt used in various chemical and biochemical applications. It consists of a tetrabutylammonium cation (Bu3N+) and a chloride anion (Cl-), with a methyl group (CH3) attached to the nitrogen atom of the ammonium cation. TBMAC is commonly used as a phase-transfer catalyst (PTC) in organic synthesis. Phase-transfer catalysis involves the transfer of reactants from one phase (usually an aqueous phase) to another phase (usually an organic phase) to facilitate a chemical reaction. TBMAC helps in the transfer of ions or molecules between these phases, allowing reactions that might not occur under standard conditions. Some common applications of TBMAC include, nucleophilic substitution reactions, halogenation reactions or alkylation and acylation reactions.
- SMILESCCCC[N+](C)(CCCC)CCCC.[Cl-]
- Storage Instruction2°C to 8°C,RT
- UNSPSC12352200