![Trichodermamide B [508218-12-0] Trichodermamide B [508218-12-0]](https://www.targetmol.com/group3/M00/3F/24/CgoaEGbkG9iEcK_MAAAAADOxj-Q019.png)
Trichodermamide B [508218-12-0]
T88748
Molecular Weight450.83
Product group Chemicals
Overview
- SupplierTargetMol Chemicals
- Product NameTrichodermamide B [508218-12-0]
- Delivery Days Customer9
- CertificationResearch Use Only
- Molecular FormulaC20H19ClN2O8
- Molecular Weight450.83
- Scientific DescriptionTrichodermamide B is a JAK/STAT3 inhibitor that demonstrates potent antiproliferative activity with an IC50 value of 0.12 microM against HCT116 cells. Furthermore, Trichodermamide B induces cell apoptosis (apoptosis) and exhibits anticancer properties.
- SMILESO(C)C1=C2C(C=C(NC(=O)C=3C[C@@]4(O)[C@@](ON3)([C@H](O)C=C[C@H]4Cl)[H])C(=O)O2)=CC=C1OC
- Storage Instruction-20°C
- UNSPSC12352200