Vanicoside B [155179-21-8]
HY-N9561
CAS Number155179-21-8
Product group Chemicals
Estimated Purity99.82
Molecular Weight956.89
Overview
- SupplierMedChem Express
- Product NameVanicoside B [155179-21-8]
- Delivery Days Customer5
- CAS Number155179-21-8
- CertificationResearch Use Only
- Estimated Purity99.82
- Molecular FormulaC49H48O20
- Molecular Weight956.89
- Scientific DescriptionVanicoside B is a phenylpropanoyl sucrose derivative, can be isolated from the herb Persicaria dissitiflora. Vanicoside B targets cyclin-dependent kinase 8 (CDK8) and exhibits anti-tumor activity. The potential mechanism is Vanicoside B blocks CDK8-mediated signaling pathways and decreases the expression of epithelial-mesenchymal transition proteins, so that it leads to cell cycle arrest and apoptosis[1][2].
- SMILESOC(C=C1)=CC=C1/C=C/C(OC[C@@]2([C@H]([C@@H]([C@H](O2)COC(/C=C/C3=CC=C(C=C3)O)=O)O)OC(/C=C/C4=CC=C(C=C4)O)=O)O[C@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)COC(/C=C/C6=CC(OC)=C(C=C6)O)=O)=O
- Storage Instruction2°C to 8°C
- UNSPSC12352200
![Vanicoside B [155179-21-8]](https://www.targetmol.com/group3/M00/02/B5/CgoaEWY7NhCES-PIAAAAADpEk0I132.png)