![Cytochalasin B [14930-96-2] Cytochalasin B [14930-96-2]](https://www.targetmol.com/group3/M00/36/C7/CgoaEGayQ36EeLZqAAAAAKFfZEw732.png)
Cytochalasin B [14930-96-2]
T7097
CAS Number14930-96-2
Product group Chemicals
Molecular Weight479.61
Overview
- SupplierTargetMol Chemicals
- Product NameCytochalasin B [14930-96-2]
- Delivery Days Customer9
- CAS Number14930-96-2
- CertificationResearch Use Only
- Chemical NameCytochalasin B
- Molecular FormulaC29H37NO5
- Molecular Weight479.61
- Scientific DescriptionCytochalasin B is a mycotoxin binding to the barbed end of actin filaments. It can disrupt the formation of actin polymers (Kd: 1.4-2.2 nM for F-actin).
- Shelf life instruction3 years
- SMILES[H][C@]12[C@H](Cc3ccccc3)NC(=O)C11OC(=O)\C=C\[C@H](O)CCC[C@@H](C)C\C=C\[C@@]1([H])[C@H](O)C(=C)[C@H]2C
- Storage Instruction-20°C
- UNSPSC12352200
