![Destruxin B [2503-26-6] Destruxin B [2503-26-6]](https://www.targetmol.com/group3/M00/36/10/CgoaEGayNl-EXIGcAAAAABOfEZ4228.png)
Destruxin B [2503-26-6]
T11009
CAS Number2503-26-6
Product group Chemicals
Molecular Weight593.766
Overview
- SupplierTargetMol Chemicals
- Product NameDestruxin B
- Delivery Days Customer44
- CAS Number2503-26-6
- Category SupplierChemical
- CertificationResearch Use Only
- Chemical NameDestruxin B
- Molecular FormulaC30H51N5O7
- Molecular Weight593.766
- Scientific DescriptionDestruxin B is a cyclic peptide with insecticidal and anticancer activity isolated from the insect pathogenic fungus Metarhizium isopliae. Destruxin B induces apoptosis of human non-small cell lung cancer cells through the Bcl-2 family-dependent mitochondrial pathway. Destruxin B through caspase-mediated apoptosis can significantly activate caspase-3 in vitro and in vivo, reducing the proliferation of tumor cells.
- Shelf life instruction3 years
- SMILESCC[C@H](C)[C@]1(C)NC(=O)[C@]2(C)CCCN2C(=O)[C@@H](CC(C)C)OC(=O)CCNC(=O)[C@H](C)N(C)C(=O)[C@H](C(C)C)N(C)C1=O
- Storage Instruction-20°C
- UNSPSC12352200