Eriocalyxin B
HY-N2303
Overview
- SupplierMedChem Express
- Product NameEriocalyxin B [84745-95-9]
- Delivery Days Customer10
- CAS Number84745-95-9
- CertificationResearch Use Only
- Estimated Purity99.93
- Molecular FormulaC20H24O5
- Molecular Weight344.40
- Scientific DescriptionEriocalyxin B is a diterpenoid compound that can be isolated from Chinese herb Isodon eriocalyx. Eriocalyxin B exhibits multiple activities, such as anti-cancer, anti-inflammatory, and inhibition of adipogenesis. Eriocalyxin B is capable of inducing apoptosis and autophagy in tumor cells. Eriocalyxin B can be used in the research of cancers, autoimmune diseases, and other conditions[1][2][3][4][5].
- SMILESO[C@]1(OC2)[C@](C[C@]3([H])C4=C)(C4=O)[C@](CC3)([H])[C@]2(C(C=C5)=O)[C@](C5(C)C)([H])[C@@H]1O
- Storage Instruction2°C to 8°C
- UNSPSC12352200