![Eriocalyxin B [84745-95-9] Eriocalyxin B [84745-95-9]](https://www.targetmol.com/group3/M00/38/04/CgoaEGayVQuEVagVAAAAABieVPk915.png)
Eriocalyxin B [84745-95-9]
TN1620
CAS Number84745-95-9
Product group Chemicals
Estimated Purity99.35%
Molecular Weight344.4
Overview
- SupplierTargetMol Chemicals
- Product NameEriocalyxin B [84745-95-9]
- Delivery Days Customer9
- CAS Number84745-95-9
- CertificationResearch Use Only
- Estimated Purity99.35%
- Molecular FormulaC20H24O5
- Molecular Weight344.4
- Scientific DescriptionEriocalyxin B induces apoptosis and cell cycle arrest in pancreatic adenocarcinoma cells through caspase- and p53-dependent pathways, should be considered a candidate for pancreatic cancer treatment; it is a specific inhibitor of STAT3, it directly targets STAT3 through a covalent linkage to inhibit the phosphorylation and activation of STAT3 and induces apoptosis of STAT3-dependent tumor cells.
- SMILES[H][C@@]12C[C@@]3(C(=O)C1=C)[C@@]([H])(CC2)[C@@]12CO[C@]3(O)[C@@H](O)[C@]1([H])C(C)(C)C=CC2=O
- Storage Instruction-20°C
- UNSPSC12352200