Flavokawain B [1775-97-9]
HY-N2132
CAS Number1775-97-9
Product group Chemicals
Estimated Purity99.99
Molecular Weight284.31
Overview
- SupplierMedChem Express
- Product NameFlavokawain B [1775-97-9]
- Delivery Days Customer9
- CAS Number1775-97-9
- CertificationResearch Use Only
- Estimated Purity99.99
- Molecular FormulaC17H16O4
- Molecular Weight284.31
- Scientific DescriptionFlavokawain B (Flavokavain B) is an orally active chalcone. Flavokawain B results in activation of caspase-9, -3 and -8, cleavage of PARP. Flavokawain B down-regulates Bcl-2 with concomitant increase in Bax level. Flavokawain B inhibits NF-kappaB, PI3K/Akt and MAPK signaling pathway. Flavokawain B exhibits Apoptotic effects. Flavokawain B inhibits MMP-9 and promotes ROS generation. Flavokawain B inhibits multiple tumors and inflammation[1][2][3][4][5][6][7][8][9][10][11][12][13].
- SMILESO=C(C1=C(OC)C=C(OC)C=C1O)/C=C/C2=CC=CC=C2
- Storage Instruction2°C to 8°C
- UNSPSC12352200
![Flavokawain B [1775-97-9]](https://www.targetmol.com/group3/M00/36/AC/CgoaEWayQj-Ed8uBAAAAAOCmkpo608.png)