![Flavokawain B [1775-97-9] Flavokawain B [1775-97-9]](https://www.targetmol.com/group3/M00/36/AC/CgoaEWayQj-Ed8uBAAAAAOCmkpo608.png)
Flavokawain B [1775-97-9]
T6S0735
CAS Number1775-97-9
Product group Chemicals
Molecular Weight284.31
Overview
- SupplierTargetMol Chemicals
- Product NameFlavokawain B [1775-97-9]
- Delivery Days Customer9
- CAS Number1775-97-9
- CertificationResearch Use Only
- Chemical NameFlavokawain B
- Molecular FormulaC17H16O4
- Molecular Weight284.31
- Scientific Description1. Flavokawain B (Flavokavain B) has potent anti-inflammatory activity, can significantly inhibit production of NO and PGE2 in LPS-induced RAW 264.7 cells. 2. Flavokawain B, the hepatotoxic constituent from kava root, induces GSH-sensitive oxidative stress through modulation of IKK/NF-kappaB and MAPK signaling pathways. 3. Flavokawain B induces apoptosis, has the potential usefulness of FKB for prevention and treatment of hormone-refractory prostate cancer in an adjuvant setting. 4. Flavokawain B acts through ROS generation and GADD153 up-regulation to regulate the expression of Bcl-2 family members, thereby inducing mitochondrial dysfunction and apoptosis in HCT116 cells.
- Shelf life instruction3 years
- SMILESCOC1=CC(OC)=C(C(=O)\C=C\C2=CC=CC=C2)C(O)=C1
- Storage Instruction-20°C
- UNSPSC12352200