Ginkgolide B [15291-77-7]

Chemodex

Ginkgolide B [15291-77-7]

10

15291-77-7

Research Use Only

>98%

C20H24O10

424.4

Chemical. CAS: 15291-77-7. Formula: C20H24O10. MW: 424.40. Ginkgolide B, a terpenoid extracted from G. biloba leaves, is a potent PAFR antagonist that inhibits platelet aggregation. Platelet-activating factor (PAF) is an important mediator of cell proliferation, angiogenesis, inflammatory response regulation, vasodilation, superoxide formation and platelet aggregation. These cellular effects are mediated through its specific G-protein coupled receptor, PAFR. Ginkgolide B has been shown to have anticancer properties by inducing apoptosis and blocking the cell cycle. Ginkgolide B also demonstrates number of other anti-inflammatory, anti-allergic, antioxidant and neuroprotective effects. - Ginkgolide B, a terpenoid extracted from G. biloba leaves, is a potent PAFR antagonist that inhibits platelet aggregation. Platelet-activating factor (PAF) is an important mediator of cell proliferation, angiogenesis, inflammatory response regulation, vasodilation, superoxide formation and platelet aggregation. These cellular effects are mediated through its specific G-protein coupled receptor, PAFR. Ginkgolide B has been shown to have anticancer properties by inducing apoptosis and blocking the cell cycle. Ginkgolide B also demonstrates number of other anti-inflammatory, anti-allergic, antioxidant and neuroprotective effects.

O=C1[C@@H](C)[C@]([C@](O1)([H])[C@@H]2O)(O)[C@]([C@]32[C@@]4([H])C[C@@H](C(C)(C)C)[C@]53[C@H]6O)(C(O4)=O)O[C@]5([H])OC6=O

-20°C,2°C to 8°C

12352200