IWR-1-endo [1127442-82-3]

AdipoGen Life Sciences

IWR-1-endo

10

1127442-82-3

Research Use Only

>98%

C25H19N3O3

409.4

Chemical. CAS: 1127442-82-3. Formula: C25H19N3O3. MW: 409.4. Potent and reversible cell permeable Wnt pathway signaling inhibitor. Inhibits Wnt-induced accumulation of beta-catenin, leading to proteasomal degradation of this protein through a destruction complex which consists of Apc, Axin2, CK1 and GSK-3beta. Stabilizes the destruction complex, increasing the level of Axin2 protein without changing the levels of Apc or GSK-3beta. Tankyrase-1 (TNKS1/PARP5a) and Tankyrase-2 (TNKS2/PARP5b) inhibitor (in vitro auto-PARsylation assay). - Potent and reversible cell permeable Wnt pathway signaling inhibitor [1, 2, 4, 5]. Inhibits Wnt-induced accumulation of beta-catenin, leading to proteasomal degradation of this protein through a destruction complex which consists of Apc, Axin2, CK1 and GSK-3beta. Stabilizes the destruction complex, increasing the level of Axin2 protein without changing the levels of Apc or GSK-3beta. Tankyrase-1 (TNKS1/PARP5a) and Tankyrase-2 (TNKS2/PARP5b) inhibitor (in vitro auto-PARsylation assay) [3, 6].

[H][C@@]12C3CC(C=C3)[C@]1([H])C(=O)N(C2=O)C1=CC=C(C=C1)C(=O)NC1=C2N=CC=CC2=CC=C1

-20°C,2°C to 8°C

12352200