Lucidenic acid B
HY-N6861
Overview
- SupplierMedChem Express
- Product NameLucidenic acid B [95311-95-8]
- Delivery Days Customer10
- CAS Number95311-95-8
- CertificationResearch Use Only
- Estimated Purity99.88
- Molecular FormulaC27H38O7
- Molecular Weight474.59
- Scientific DescriptionLucidenic acid B is a natural compound isolated from Ganoderma lucidum, induces apoptosis of cancer cells, and causes the activation of caspase-9 and caspase-3, and cleavage of PARP. Lucidenic acid B does not affect the cell cycle profile, or the number of necrotic cells[1].
- SMILESC[C@]12C3=C(C([C@@H](O)[C@@]1([C@]([C@H](C)CCC(O)=O)([H])CC2=O)C)=O)[C@@]4([C@@](C(C)(C(CC4)=O)C)([H])C[C@@H]3O)C
- Storage Instruction-20°C
- UNSPSC12352200