![Lucidenic acid B [95311-95-8] Lucidenic acid B [95311-95-8]](https://www.targetmol.com/group3/M00/02/63/CgoaEWY7LHKEOfdYAAAAADpt4R8527.png)
Lucidenic acid B [95311-95-8]
TN1880
CAS Number95311-95-8
Product group Chemicals
Molecular Weight474.59
Overview
- SupplierTargetMol Chemicals
- Product NameLucidenic acid B [95311-95-8]
- Delivery Days Customer9
- CAS Number95311-95-8
- CertificationResearch Use Only
- Molecular FormulaC27H38O7
- Molecular Weight474.59
- Scientific DescriptionLucidenic acid B (Lucidenicacid B), a natural compound extracted from Ganoderma lucidum, induces activation of caspase-9 and caspase-3 and cleavage of PARP, which can induce apoptosis in human leukemia cells through mitochondrial mediation. Lucidenic acid B inhibits PMA-induced invasion of human hepatocellular carcinoma cells by inactivating the MAPK/ERK signaling pathway and decreasing the binding activity of NF-kappaB and AP-1. Lucidenic acid B had no effect on cell cycle and necrotic cells.
- SMILESC[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)C(=O)CC4)[H])C(=O)[C@@H](O)[C@]1(C)[C@@]([C@@H](CCC(O)=O)C)(CC2=O)[H]
- Storage Instruction-20°C
- UNSPSC12352200