
Chemical Structure
NSC697923
AG-CR1-3519
Overview
- SupplierAdipoGen Life Sciences
- Product NameNSC697923
- Delivery Days Customer10
- CAS Number343351-67-7
- CertificationResearch Use Only
- Estimated Purity>98%
- Molecular FormulaC11H9NO5S
- Molecular Weight267.3
- Scientific DescriptionChemical. CAS: 343351-67-7. Formula: C11H9NO5S. MW: 267.3. Selective Ub-conjugating enzyme (E2) complex Ubc13-Uev1A inhibitor. Inhibits the formation of the Ubc13~Ub conjugate. NF-kappaB activation inhibitor. Inhibits proliferation and survival of ABC-DLBCL and GCB-DLBCL (diffuse large B cell lymphoma) cells. - Selective Ub-conjugating enzyme (E2) complex Ubc13-Uev1A inhibitor. Inhibits the formation of the Ubc13~Ub conjugate. NF-kappaB activation inhibitor. Inhibits proliferation and survival of ABC-DLBCL and GCB-DLBCL (diffuse large B cell lymphoma) cells.
- SMILESCC1=CC=C(C=C1)S(=O)(=O)C1=CC=C(O1)[N+]([O-])=O
- Storage Instruction-20°C,2°C to 8°C
- UNSPSC12352200