CgoaEWY7N_OEQIBiAAAAAAWj0yQ817.png
RGB-286638 [784210-87-3]
T73196
Overview
- SupplierTargetMol Chemicals
- Product NameRGB-286638 [784210-87-3]
- Delivery Days Customer114
- CAS Number784210-87-3
- Category SupplierChemical
- CertificationResearch Use Only
- Chemical NameRGB-286638
- Molecular FormulaC29H37Cl2N7O4
- Molecular Weight618.55
- Scientific DescriptionRGB-286638 is a multi-target CDK inhibitor that effectively hampers the kinase activity of a range of cyclin-CDK complexes, including cyclin T1-CDK9 (IC50 = 1 nM), cyclin B1-CDK1 (IC50 = 2 nM), cyclin E-CDK2 (IC50 = 3 nM), cyclin D1-CDK4 (IC50 = 4 nM), cyclin E-CDK3 (IC50 = 5 nM), and p35-CDK5 (IC50 = 5 nM). Additionally, it inhibits other kinases such as GSK-3beta (IC50 = 3 nM), TAK1 (IC50 = 5 nM), Jak2 (IC50 = 50 nM), and MEK1 (IC50 = 54 nM), showcasing its versatile inhibitory potential.
- Shelf life instruction3 years
- SMILESCl.Cl.O=C(NC1=CC=CC=2C=3NN=C(C=4C=CC(=CC4)CN5CCN(CCOC)CC5)C3C(=O)C12)NN6CCOCC6
- Storage Instruction-20°C
- UNSPSC12352200