![Shizukaol B [142279-40-1] Shizukaol B [142279-40-1]](https://www.targetmol.com/group3/M00/02/AD/CgoaEWY7NQKED1meAAAAAKEciOg178.png)
Shizukaol B [142279-40-1]
TN5011
Molecular Weight732.77
Product group Chemicals
Overview
- SupplierTargetMol Chemicals
- Product NameShizukaol B [142279-40-1]
- Delivery Days Customer9
- CertificationResearch Use Only
- Molecular FormulaC40H44O13
- Molecular Weight732.77
- Scientific DescriptionShizukaol B exerts anti-inflammatory effects in LPS-activated microglia partly by modulating JNK-AP-1 signaling pathway; it also shows significant anti-neuroinflammatory effects by inhibiting nitric-oxide (NO) production in lipopolysaccharide (LPS)-stimulated murine BV-2 microglial cells with relatively low cytotoxicity. Shizukaol B exhibits anti-HIV-1 replication activities in both wild-type HIV-1 and two NNRTIs-resistant strains, it also has significant cytotoxicities against C8166 cells. Shizukaol B prevents monocyte adhesion to HUVEC through the inhibition of cell adhesion molecules expression stimulated by TNF-alpha.
- SMILESCOC(=O)C(\C)=C1\[C@H]2C3=C(C[C@H]4[C@@]5(C)[C@@H]6C[C@@H]6[C@@]6(O)COC(=O)\C(C)=C\COC(=O)CCC(=O)OCC7=C(C[C@H]56)[C@@]24OC7=O)[C@H]2C[C@H]2[C@]3(C)[C@@H](O)C1=O
- Storage Instruction-20°C
- UNSPSC12352200