Lupeol [545-47-1]

Chemodex

Lupeol [545-47-1]

10

545-47-1

Research Use Only

>97%

C30H50O

426.72

Chemical. CAS: 545-47-1. Formula: C30H50O. MW: 426.72. Lupeol, is a dietary triterpene found in certain fruits, vegetables, and medicinal plants. Lupeol has been shown tohave a broad range of activities, including antioxidant, anti-inflammatory, anticancer, antihyperglycemic, antidyslipidemic, antimutagenic, anti-diabetic, anti-asthma, antiprotozoal, antimicrobial, cardioprotective, hepatoprotective, nephroprotective and neuroprotective properties. It is a multi-target agent targeting proteins such as alpha-glucosidase, alpha-amylase, protein tyrosine phosphatase 1B (PTP 1B) and TCA cycle enzymes and targeting pathways such as IL-1 receptor-associated kinase-mediated toll-like receptor 4 (IRAK-TLR4), Bcl-2 family, nuclear factor kappa B (NF-kappa), phosphatidylinositol-3-kinase (PI3-K)/Akt and Wnt/beta-catenin signaling pathways. - Lupeol, is a dietary triterpene found in certain fruits, vegetables, and medicinal plants. Lupeol has been shown tohave a broad range of activities, including antioxidant, anti-inflammatory, anticancer, antihyperglycemic, antidyslipidemic, antimutagenic, anti-diabetic, anti-asthma, antiprotozoal, antimicrobial, cardioprotective, hepatoprotective, nephroprotective and neuroprotective properties. It is a multi-target agent targeting proteins such as alpha-glucosidase, alpha-amylase, protein tyrosine phosphatase 1B (PTP 1B) and TCA cycle enzymes and targeting pathways such as IL-1 receptor-associated kinase-mediated toll-like receptor 4 (IRAK-TLR4), Bcl-2 family, nuclear factor kappa B (NF-kappa), phosphatidylinositol-3-kinase (PI3-K)/Akt and Wnt/beta-catenin signaling pathways.

C[C@@]12CC[C@@]3(C)[C@]4(C)CC[C@@]5([H])C(C)(C)[C@@H](O)CC[C@]5(C)[C@@]4([H])CC[C@]3([H])[C@@]1([H])[C@H](C(C)=C)CC2

2°C to 8°C

12352200